

Off-white solid, soluble in DMSO (little), methanol (little), density 1.302±0.06 g/cm3(Predicted)
Pesticide intermediates; used as intermediates of herbicides such as Phyllostadimer, High-efficiency Gaynon, Precise Stabilizer, Precise Quinquefoil, Kynurethrin, etc.
(R)-2-(4-Hydroxyphenoxy)propionic Acid is a high-purity chiral compound widely used in the pharmaceutical and chemical industries. It serves as a key intermediate in the synthesis of enantiomerically pure drugs and other biologically active molecules.
| Melting point | 145-148 °C (lit.) |
| alpha | 58 º (c=1, MeOH) |
| Boiling point | 367.5±17.0 °C(Predicted) |
| density | 1.302±0.06 g/cm3(Predicted) |
| refractive index | 38 ° (C=0.1, MeOH) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 3.32±0.10(Predicted) |
| form | Solid |
| color | Off-White |
| optical activity | [α]20/D +58°, c = 1 in methanol |
| InChI | InChI=1S/C9H10O4/c1-6(9(11)12)13-8-4-2-7(10)3-5-8/h2-6,10H,1H3,(H,11,12)/t6-/m1/s1 |
| InChIKey | AQIHDXGKQHFBNW-ZCFIWIBFSA-N |
| SMILES | C(O)(=O)[C@H](OC1=CC=C(O)C=C1)C |
| CAS DataBase Reference | 94050-90-5(CAS DataBase Reference) |
Pharmaceutical Intermediates:
DHPPA is a critical precursor in the synthesis of various active pharmaceutical ingredients (APIs), especially those requiring enantiomeric purity for efficacy and safety.
Chiral Building Block:
Its stereochemical configuration makes it valuable for the construction of complex molecules in organic synthesis.
Research and Development:
Widely used in academic and industrial research for studying chiral reactions and developing new drugs.
Agrochemical Production:
DHPPA is used in the synthesis of herbicides and plant growth regulators, where stereoselectivity is essential for activity.
The hydroxyl and carboxylic acid groups in (R)-2-(4-Hydroxyphenoxy)propionic Acid provide reactive sites for further chemical modifications. The compound's chiral nature ensures that it can participate in stereoselective reactions, crucial for producing enantiomerically pure products.
Protective Equipment:
Use gloves, safety goggles, and lab coats when handling DHPPA. Perform operations in a fume hood to minimize exposure.
Storage:
Store in a tightly sealed container, away from light and moisture, in a cool and dry environment.
Hazards:
Inhalation: May cause respiratory irritation.
Skin Contact: May cause irritation upon prolonged exposure.
Eye Contact: May cause serious eye irritation.
Ingestion: Harmful if swallowed.
First Aid Measures:
Inhalation: Move to fresh air; seek medical attention if symptoms persist.
Skin Contact: Wash with soap and water.
Eye Contact: Rinse with water for several minutes and seek medical advice.
Ingestion: Do not induce vomiting; consult a doctor immediately.
(R)-2-(4-Hydroxyphenoxy)propionic Acid (DHPPA) is a versatile and high-purity chiral compound essential for pharmaceutical synthesis, research, and agrochemical production. Its enantiomeric purity ensures its effectiveness in applications requiring stereochemical precision. Proper storage and handling are necessary to maintain its quality and safety during use.
1. What is the primary use of (R)-2-(4-Hydroxyphenoxy)propionic Acid?
It is primarily used as a chiral intermediate in pharmaceutical and agrochemical synthesis.
2. How should DHPPA be stored?
Store in a cool, dry place, away from light and moisture, in tightly sealed containers.
3. Is DHPPA soluble in water?
Yes, it is soluble in water and other polar solvents like ethanol.
4. What precautions are necessary when handling DHPPA?
Wear appropriate protective equipment, work in a well-ventilated area, and avoid direct contact or inhalation.
5. Can DHPPA be used in stereoselective reactions?
Yes, its chiral nature makes it ideal for stereoselective organic synthesis.